Abnormal bone ossification
Symptom Information:
| Symptom ID: | HPO:0011849 | ||||
| Synonyms: |
|
||||
| Quality: | |||||
| Cross references: |
|
||||
| Is a (Direct Parents): |
|
||||
| Is a (Whole tree): |
HPO:
All(HPO:0000001) Phenotypic abnormality(HPO:0000118) Abnormality of the skeletal system(HPO:0000924) Abnormality of skeletal morphology(HPO:0011842) Abnormal bone structure(HPO:0003330) Abnormal bone ossification(HPO:0011849) MedDRA: |
||||
| Database Frequency: | 35 / 7739 | ||||
| Resource: |
All diseases associated with this symptom:
| Achondrogenesis | (Orphanet:932) |
| Achondrogenesis type 1A | (Orphanet:93299) |
| Achondrogenesis type 1B | (Orphanet:93298) |
| Achondrogenesis type 2 | (Orphanet:93296) |
| Astley-Kendall dysplasia | (Orphanet:85175) |
| Boomerang dysplasia | (Orphanet:1263) |
| Bowed tibiae - radial anomalies - osteopenia - fractures | (Orphanet:3331) |
| Cartilage-hair hypoplasia | (Orphanet:175) |
| Cleft palate - short stature - vertebral anomalies | (Orphanet:2015) |
| Craniomicromelic syndrome | (Orphanet:1524) |
| Cystinosis | (Orphanet:213) |
| Geroderma osteodysplastica | (Orphanet:2078) |
| Greenberg dysplasia | (Orphanet:1426) |
| Hip dysplasia, Beukes type | (Orphanet:2114) |
| Lethal recessive chondrodysplasia | (Orphanet:1423) |
| Marfanoid habitus - intellectual deficit, autosomal recessive | (Orphanet:2463) |
| Metaphyseal chondrodysplasia, Schmid type | (Orphanet:174) |
| Metatropic dysplasia | (Orphanet:2635) |
| Microcephalic primordial dwarfism, Toriello type | (Orphanet:2643) |
| Monosomy 5p | (Orphanet:281) |
| Multiple epiphyseal dysplasia, Lowry type | (Orphanet:166016) |
| Non-rhizomelic chondrodysplasia punctata | (Orphanet:176) |
| Ophthalmomandibulomelic dysplasia | (Orphanet:2741) |
| Osteocraniostenosis | (Orphanet:2763) |
| Osteoglophonic dwarfism | (Orphanet:2645) |
| Pacman dysplasia | (Orphanet:1952) |
| Qazi-Markouizos syndrome | (Orphanet:3010) |
| Schinzel-Giedion syndrome | (Orphanet:798) |
| Schwartz-Jampel syndrome | (Orphanet:800) |
| Seckel syndrome | (Orphanet:808) |
| Senior-Loken syndrome | (Orphanet:3156) |
| Spondyloepimetaphyseal dysplasia with joint laxity | (Orphanet:93359) |
| Spondyloepimetaphyseal dysplasia with multiple dislocations | (Orphanet:93360) |
| Spondyloepimetaphyseal dysplasia, Shohat type | (Orphanet:93352) |
| Tyrosinemia type 1 | (Orphanet:882) |