Abnormal tarsal ossification
Symptom Information:
| Symptom ID: | HPO:0008369 | ||||
| Synonyms: |
|
||||
| Quality: | |||||
| Cross references: |
|
||||
| Is a (Direct Parents): |
|
||||
| Is a (Whole tree): |
HPO:
All(HPO:0000001) Phenotypic abnormality(HPO:0000118) Abnormality of the skeletal system(HPO:0000924) Abnormality of skeletal morphology(HPO:0011842) Abnormal bone structure(HPO:0003330) Abnormal bone ossification(HPO:0011849) Abnormal foot bone ossification(HPO:0010675) Abnormal tarsal ossification(HPO:0008369) Abnormal appendicular skeleton morphology(HPO:0011844) Abnormality of limb bone morphology(HPO:0002813) Abnormality of the lower limb(HPO:0002814) Abnormality of the foot(HPO:0001760) Abnormal foot bone ossification(HPO:0010675) Abnormal tarsal ossification(HPO:0008369) Abnormality of the tarsal bones(HPO:0001850) Abnormal tarsal ossification(HPO:0008369) MedDRA: |
||||
| Database Frequency: | 0 / 7739 | ||||
| Resource: |